C19H18N4O2S — CID 135924344
2-methoxy-4-(7-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl)phenol (PubChem CID 135924344) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 2-methoxy-4-(7-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl)phenol.
| Compound Name | 2-methoxy-4-(7-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl)phenol |
|---|---|
| PubChem CID | 135924344 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-methoxy-4-(7-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl)phenol |
| SMILES | COc1cc(-c2nnc3c4c5c(sc4nc(C)n23)CCCC5)ccc1O |
| InChI | InChI=1S/C19H18N4O2S/c1-10-20-19-16(12-5-3-4-6-15(12)26-19)18-22-21-17(23(10)18)11-7-8-13(24)14(9-11)25-2/h7-9,24H,3-6H2,1-2H3 |
| InChIKey | FONSGFNDCFZBGV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |