C20H28N4O4 — CID 135924645
N-(2-hydroxy-6-methoxy-1-pentylindol-3-yl)imino-2-morpholin-4-ylacetamide (PubChem CID 135924645) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-(2-hydroxy-6-methoxy-1-pentylindol-3-yl)imino-2-morpholin-4-ylacetamide.
| Compound Name | N-(2-hydroxy-6-methoxy-1-pentylindol-3-yl)imino-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 135924645 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | N-(2-hydroxy-6-methoxy-1-pentylindol-3-yl)imino-2-morpholin-4-ylacetamide |
| SMILES | CCCCCn1c(O)c(/N=N/C(=O)CN2CCOCC2)c2ccc(OC)cc21 |
| InChI | InChI=1S/C20H28N4O4/c1-3-4-5-8-24-17-13-15(27-2)6-7-16(17)19(20(24)26)22-21-18(25)14-23-9-11-28-12-10-23/h6-7,13,26H,3-5,8-12,14H2,1-2H3/b22-21+ |
| InChIKey | UHHAZCDRVQJHRE-QURGRASLSA-N |
| XLogP | 3.49 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|