About 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol
5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol (PubChem CID 135924981) has the molecular formula C13H17N3O2S
and a molecular weight of 279.36 g/mol. Its IUPAC name is 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol.
Molecular Properties
| Compound Name | 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol |
| PubChem CID | 135924981 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(C)cs2)=C(O)CN1C[C@H]1CCCO1 |
| InChI | InChI=1S/C13H17N3O2S/c1-8-7-19-13(15-8)11-10(17)6-16(12(11)14)5-9-3-2-4-18-9/h7,9,14,17H,2-6H2,1H3/b14-12-/t9-/m1/s1 |
| InChIKey | AAYJJUXQGBMJAR-USPJWIJHSA-N |
| XLogP | 2.19 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol?
The IUPAC name of 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol (CID 135924981) is 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol.
What is the SMILES notation for 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol?
The canonical SMILES for 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol is [H]/N=C1/C(c2nc(C)cs2)=C(O)CN1C[C@H]1CCCO1.
What is the InChIKey of 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol?
The InChIKey is AAYJJUXQGBMJAR-USPJWIJHSA-N. The full InChI is InChI=1S/C13H17N3O2S/c1-8-7-19-13(15-8)11-10(17)6-16(12(11)14)5-9-3-2-4-18-9/h7,9,14,17H,2-6H2,1H3/b14-12-/t9-/m1/s1.
What are the key properties of 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol?
5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol has a molecular weight of 279.36 g/mol, XLogP of 2.19, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-imino-4-(4-methyl-1,3-thiazol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-2H-pyrrol-3-ol is sourced from PubChem (CID 135924981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).