About 5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol
5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol (PubChem CID 135925028) has the molecular formula C19H16N4O2S2
and a molecular weight of 396.50 g/mol. Its IUPAC name is 5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol |
| PubChem CID | 135925028 |
| Molecular Formula | C19H16N4O2S2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol |
| SMILES | C=CCn1c(O)c(C=C2C=Nc3cc(OC)ccc32)sc1=Nc1nccs1 |
| InChI | InChI=1S/C19H16N4O2S2/c1-3-7-23-17(24)16(27-19(23)22-18-20-6-8-26-18)9-12-11-21-15-10-13(25-2)4-5-14(12)15/h3-6,8-11,24H,1,7H2,2H3 |
| InChIKey | RYXJGMQCAQLQID-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol?
The IUPAC name of 5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol (CID 135925028) is 5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol.
What is the SMILES notation for 5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol?
The canonical SMILES for 5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol is C=CCn1c(O)c(C=C2C=Nc3cc(OC)ccc32)sc1=Nc1nccs1.
What is the InChIKey of 5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol?
The InChIKey is RYXJGMQCAQLQID-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O2S2/c1-3-7-23-17(24)16(27-19(23)22-18-20-6-8-26-18)9-12-11-21-15-10-13(25-2)4-5-14(12)15/h3-6,8-11,24H,1,7H2,2H3.
What are the key properties of 5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol?
5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol has a molecular weight of 396.50 g/mol, XLogP of 4.40, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-methoxyindol-3-ylidene)methyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol is sourced from PubChem (CID 135925028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).