About 3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile
3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile (PubChem CID 135925087) has the molecular formula C19H16N4O
and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile |
| PubChem CID | 135925087 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(-c2ccnc(Nc3cccc(C#N)c3)n2)cc(C)c1O |
| InChI | InChI=1S/C19H16N4O/c1-12-8-15(9-13(2)18(12)24)17-6-7-21-19(23-17)22-16-5-3-4-14(10-16)11-20/h3-10,24H,1-2H3,(H,21,22,23) |
| InChIKey | VZKXOFJJRFDWLJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile?
The IUPAC name of 3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile (CID 135925087) is 3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile.
What is the SMILES notation for 3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile?
The canonical SMILES for 3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile is Cc1cc(-c2ccnc(Nc3cccc(C#N)c3)n2)cc(C)c1O.
What is the InChIKey of 3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile?
The InChIKey is VZKXOFJJRFDWLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O/c1-12-8-15(9-13(2)18(12)24)17-6-7-21-19(23-17)22-16-5-3-4-14(10-16)11-20/h3-10,24H,1-2H3,(H,21,22,23).
What are the key properties of 3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile?
3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile has a molecular weight of 316.36 g/mol, XLogP of 4.08, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(4-hydroxy-3,5-dimethylphenyl)pyrimidin-2-yl]amino]benzonitrile is sourced from PubChem (CID 135925087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).