C34H43ClN4 — CID 135925114
1-[8-(3,3-dimethyl-4,9-dihydropyrido[3,4-b]indol-1-yl)octyl]-3,3-dimethyl-4,9-dihydropyrido[3,4-b]indole;hydrochloride (PubChem CID 135925114) has the molecular formula C34H43ClN4 and a molecular weight of 543.20 g/mol. Its IUPAC name is 1-[8-(3,3-dimethyl-4,9-dihydropyrido[3,4-b]indol-1-yl)octyl]-3,3-dimethyl-4,9-dihydropyrido[3,4-b]indole;hydrochloride.
| Compound Name | 1-[8-(3,3-dimethyl-4,9-dihydropyrido[3,4-b]indol-1-yl)octyl]-3,3-dimethyl-4,9-dihydropyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 135925114 |
| Molecular Formula | C34H43ClN4 |
| Molecular Weight | 543.20 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | 1-[8-(3,3-dimethyl-4,9-dihydropyrido[3,4-b]indol-1-yl)octyl]-3,3-dimethyl-4,9-dihydropyrido[3,4-b]indole;hydrochloride |
| SMILES | CC1(C)Cc2c([nH]c3ccccc23)C(CCCCCCCCC2=NC(C)(C)Cc3c2[nH]c2ccccc32)=N1.Cl |
| InChI | InChI=1S/C34H42N4.ClH/c1-33(2)21-25-23-15-11-13-17-27(23)35-31(25)29(37-33)19-9-7-5-6-8-10-20-30-32-26(22-34(3,4)38-30)24-16-12-14-18-28(24)36-32;/h11-18,35-36H,5-10,19-22H2,1-4H3;1H |
| InChIKey | OYOJHUZMTWDSTE-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 56.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.20 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|