C18H17N5O2S — CID 135925306
3-(6-ethyl-3,5-dihydroxy-2-pyridinyl)-4-(1-methylindol-5-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 135925306) has the molecular formula C18H17N5O2S and a molecular weight of 367.43 g/mol. Its IUPAC name is 3-(6-ethyl-3,5-dihydroxy-2-pyridinyl)-4-(1-methylindol-5-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(6-ethyl-3,5-dihydroxy-2-pyridinyl)-4-(1-methylindol-5-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135925306 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 3-(6-ethyl-3,5-dihydroxy-2-pyridinyl)-4-(1-methylindol-5-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1nc(-c2n[nH]c(=S)n2-c2ccc3c(ccn3C)c2)c(O)cc1O |
| InChI | InChI=1S/C18H17N5O2S/c1-3-12-14(24)9-15(25)16(19-12)17-20-21-18(26)23(17)11-4-5-13-10(8-11)6-7-22(13)2/h4-9,24-25H,3H2,1-2H3,(H,21,26) |
| InChIKey | MBKXXZHPXKWIOF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 91.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|