C16H14BrNO5S — CID 135926276
(E)-3-(3-bromo-4,5-dihydroxyphenyl)-N-[(2,3,4-trihydroxyphenyl)methyl]prop-2-enethioamide (PubChem CID 135926276) has the molecular formula C16H14BrNO5S and a molecular weight of 412.26 g/mol. Its IUPAC name is (E)-3-(3-bromo-4,5-dihydroxyphenyl)-N-[(2,3,4-trihydroxyphenyl)methyl]prop-2-enethioamide.
| Compound Name | (E)-3-(3-bromo-4,5-dihydroxyphenyl)-N-[(2,3,4-trihydroxyphenyl)methyl]prop-2-enethioamide |
|---|---|
| PubChem CID | 135926276 |
| Molecular Formula | C16H14BrNO5S |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | (E)-3-(3-bromo-4,5-dihydroxyphenyl)-N-[(2,3,4-trihydroxyphenyl)methyl]prop-2-enethioamide |
| SMILES | Oc1cc(/C=C/C(=S)NCc2ccc(O)c(O)c2O)cc(Br)c1O |
| InChI | InChI=1S/C16H14BrNO5S/c17-10-5-8(6-12(20)15(10)22)1-4-13(24)18-7-9-2-3-11(19)16(23)14(9)21/h1-6,19-23H,7H2,(H,18,24)/b4-1+ |
| InChIKey | SIUHXQQPNZZXDC-DAFODLJHSA-N |
| XLogP | 3.11 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|