C22H28N7O+ — CID 135926582
3-[2-[(2S)-butan-2-yl]-3-hydroxy-6-(1H-indol-3-yl)imidazo[1,2-a]pyrazin-8-yl]propyl-(diaminomethylidene)azanium (PubChem CID 135926582) has the molecular formula C22H28N7O+ and a molecular weight of 406.51 g/mol. Its IUPAC name is 3-[2-[(2S)-butan-2-yl]-3-hydroxy-6-(1H-indol-3-yl)imidazo[1,2-a]pyrazin-8-yl]propyl-(diaminomethylidene)azanium.
| Compound Name | 3-[2-[(2S)-butan-2-yl]-3-hydroxy-6-(1H-indol-3-yl)imidazo[1,2-a]pyrazin-8-yl]propyl-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 135926582 |
| Molecular Formula | C22H28N7O+ |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 3-[2-[(2S)-butan-2-yl]-3-hydroxy-6-(1H-indol-3-yl)imidazo[1,2-a]pyrazin-8-yl]propyl-(diaminomethylidene)azanium |
| SMILES | CC[C@H](C)c1nc2c(CCC[NH+]=C(N)N)nc(-c3c[nH]c4ccccc34)cn2c1O |
| InChI | InChI=1S/C22H27N7O/c1-3-13(2)19-21(30)29-12-18(15-11-26-16-8-5-4-7-14(15)16)27-17(20(29)28-19)9-6-10-25-22(23)24/h4-5,7-8,11-13,26,30H,3,6,9-10H2,1-2H3,(H4,23,24,25)/p+1/t13-/m0/s1 |
| InChIKey | AVNJFDTZJJNPKF-ZDUSSCGKSA-O |
| XLogP | 1.38 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|