C15H10Cl2FN3O2S — CID 135926949
2,4-dichloro-5-fluoro-N-methyl-N-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]benzamide (PubChem CID 135926949) has the molecular formula C15H10Cl2FN3O2S and a molecular weight of 386.24 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-methyl-N-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-methyl-N-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 135926949 |
| Molecular Formula | C15H10Cl2FN3O2S |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-methyl-N-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]benzamide |
| SMILES | CN(Cc1nc2ccsc2c(=O)[nH]1)C(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H10Cl2FN3O2S/c1-21(15(23)7-4-10(18)9(17)5-8(7)16)6-12-19-11-2-3-24-13(11)14(22)20-12/h2-5H,6H2,1H3,(H,19,20,22) |
| InChIKey | NPPWMQLPPPHMLG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|