C19H14N4O2 — CID 135927897
N-[6-(4-hydroxyphenyl)-1H-indazol-4-yl]pyridine-2-carboxamide (PubChem CID 135927897) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is N-[6-(4-hydroxyphenyl)-1H-indazol-4-yl]pyridine-2-carboxamide.
| Compound Name | N-[6-(4-hydroxyphenyl)-1H-indazol-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135927897 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N-[6-(4-hydroxyphenyl)-1H-indazol-4-yl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1cc(-c2ccc(O)cc2)cc2[nH]ncc12)c1ccccn1 |
| InChI | InChI=1S/C19H14N4O2/c24-14-6-4-12(5-7-14)13-9-17(15-11-21-23-18(15)10-13)22-19(25)16-3-1-2-8-20-16/h1-11,24H,(H,21,23)(H,22,25) |
| InChIKey | OVFDOYSALNWSNU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |