About 8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one
8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 135927937) has the molecular formula C18H14ClN3O2S
and a molecular weight of 371.85 g/mol. Its IUPAC name is 8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| PubChem CID | 135927937 |
| Molecular Formula | C18H14ClN3O2S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | Cc1c(O)cccc1NCc1nc2c(sc3ccc(Cl)cc32)c(=O)[nH]1 |
| InChI | InChI=1S/C18H14ClN3O2S/c1-9-12(3-2-4-13(9)23)20-8-15-21-16-11-7-10(19)5-6-14(11)25-17(16)18(24)22-15/h2-7,20,23H,8H2,1H3,(H,21,22,24) |
| InChIKey | AQCMZXFFUKRLMT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one?
The IUPAC name of 8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (CID 135927937) is 8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one?
The canonical SMILES for 8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one is Cc1c(O)cccc1NCc1nc2c(sc3ccc(Cl)cc32)c(=O)[nH]1.
What is the InChIKey of 8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one?
The InChIKey is AQCMZXFFUKRLMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClN3O2S/c1-9-12(3-2-4-13(9)23)20-8-15-21-16-11-7-10(19)5-6-14(11)25-17(16)18(24)22-15/h2-7,20,23H,8H2,1H3,(H,21,22,24).
What are the key properties of 8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one?
8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one has a molecular weight of 371.85 g/mol, XLogP of 4.42, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-2-[(3-hydroxy-2-methylanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 135927937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).