C22H24N4O2S — CID 135927970
8-[4-(3-aminopropoxy)phenyl]-2-[(dimethylamino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 135927970) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 8-[4-(3-aminopropoxy)phenyl]-2-[(dimethylamino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
| Compound Name | 8-[4-(3-aminopropoxy)phenyl]-2-[(dimethylamino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135927970 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 8-[4-(3-aminopropoxy)phenyl]-2-[(dimethylamino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | CN(C)Cc1nc2c(sc3ccc(-c4ccc(OCCCN)cc4)cc32)c(=O)[nH]1 |
| InChI | InChI=1S/C22H24N4O2S/c1-26(2)13-19-24-20-17-12-15(6-9-18(17)29-21(20)22(27)25-19)14-4-7-16(8-5-14)28-11-3-10-23/h4-9,12H,3,10-11,13,23H2,1-2H3,(H,24,25,27) |
| InChIKey | OKUXRVPIXCSROX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|