C26H27N7 — CID 135928480
[4-[3-[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-indazol-6-yl]phenyl]methanamine (PubChem CID 135928480) has the molecular formula C26H27N7 and a molecular weight of 437.55 g/mol. Its IUPAC name is [4-[3-[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-indazol-6-yl]phenyl]methanamine.
| Compound Name | [4-[3-[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-indazol-6-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 135928480 |
| Molecular Formula | C26H27N7 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | [4-[3-[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-indazol-6-yl]phenyl]methanamine |
| SMILES | CN1CCN(c2cccc3[nH]c(-c4n[nH]c5cc(-c6ccc(CN)cc6)ccc45)nc23)CC1 |
| InChI | InChI=1S/C26H27N7/c1-32-11-13-33(14-12-32)23-4-2-3-21-25(23)29-26(28-21)24-20-10-9-19(15-22(20)30-31-24)18-7-5-17(16-27)6-8-18/h2-10,15H,11-14,16,27H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | SAKBODKHQMFEKY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |