About methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate
methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate (PubChem CID 135928512) has the molecular formula C13H10Cl2N2O4
and a molecular weight of 329.14 g/mol. Its IUPAC name is methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate |
| PubChem CID | 135928512 |
| Molecular Formula | C13H10Cl2N2O4 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(Cc2ccc(Cl)c(Cl)c2)[nH]c(=O)c1O |
| InChI | InChI=1S/C13H10Cl2N2O4/c1-21-13(20)10-11(18)12(19)17-9(16-10)5-6-2-3-7(14)8(15)4-6/h2-4,18H,5H2,1H3,(H,16,17,19) |
| InChIKey | BAQOVWBGJHUBFR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate?
The IUPAC name of methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate (CID 135928512) is methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate.
What is the SMILES notation for methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate?
The canonical SMILES for methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate is COC(=O)c1nc(Cc2ccc(Cl)c(Cl)c2)[nH]c(=O)c1O.
What is the InChIKey of methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate?
The InChIKey is BAQOVWBGJHUBFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N2O4/c1-21-13(20)10-11(18)12(19)17-9(16-10)5-6-2-3-7(14)8(15)4-6/h2-4,18H,5H2,1H3,(H,16,17,19).
What are the key properties of methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate?
methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate has a molecular weight of 329.14 g/mol, XLogP of 2.16, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3,4-dichlorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate is sourced from PubChem (CID 135928512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).