About (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one
(4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one (PubChem CID 135928617) has the molecular formula C19H17N3OS
and a molecular weight of 335.43 g/mol. Its IUPAC name is (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one |
| PubChem CID | 135928617 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one |
| SMILES | [H]/N=C1C(=C2\Nc3ccccc3S2)/CC(=O)N/1CCc1ccccc1 |
| InChI | InChI=1S/C19H17N3OS/c20-18-14(19-21-15-8-4-5-9-16(15)24-19)12-17(23)22(18)11-10-13-6-2-1-3-7-13/h1-9,20-21H,10-12H2/b19-14+,20-18- |
| InChIKey | RFKSELDYKRSPKI-NUEPIQMRSA-N |
| XLogP | 3.87 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one?
The IUPAC name of (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one (CID 135928617) is (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one.
What is the SMILES notation for (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one?
The canonical SMILES for (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one is [H]/N=C1C(=C2\Nc3ccccc3S2)/CC(=O)N/1CCc1ccccc1.
What is the InChIKey of (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one?
The InChIKey is RFKSELDYKRSPKI-NUEPIQMRSA-N. The full InChI is InChI=1S/C19H17N3OS/c20-18-14(19-21-15-8-4-5-9-16(15)24-19)12-17(23)22(18)11-10-13-6-2-1-3-7-13/h1-9,20-21H,10-12H2/b19-14+,20-18-.
What are the key properties of (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one?
(4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one has a molecular weight of 335.43 g/mol, XLogP of 3.87, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2-phenylethyl)pyrrolidin-2-one is sourced from PubChem (CID 135928617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).