C25H48O4Si2 — CID 135929175
tert-butyl-[(1S)-1-[(2R,3S)-3-[(2S,3S)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-3-methyloxiran-2-yl]oxiran-2-yl]but-3-enoxy]-dimethylsilane (PubChem CID 135929175) has the molecular formula C25H48O4Si2 and a molecular weight of 468.83 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[(2R,3S)-3-[(2S,3S)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-3-methyloxiran-2-yl]oxiran-2-yl]but-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S)-1-[(2R,3S)-3-[(2S,3S)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-3-methyloxiran-2-yl]oxiran-2-yl]but-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135929175 |
| Molecular Formula | C25H48O4Si2 |
| Molecular Weight | 468.83 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | tert-butyl-[(1S)-1-[(2R,3S)-3-[(2S,3S)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-3-methyloxiran-2-yl]oxiran-2-yl]but-3-enoxy]-dimethylsilane |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1[C@@H]1O[C@@]1(C)C[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H48O4Si2/c1-14-16-19(29-31(12,13)24(6,7)8)20-21(26-20)22-25(9,27-22)17-18(15-2)28-30(10,11)23(3,4)5/h14-15,18-22H,1-2,16-17H2,3-13H3/t18-,19+,20+,21+,22+,25+/m1/s1 |
| InChIKey | TZCXSOUQYKBYSL-BHEKSSHISA-N |
| XLogP | 6.84 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.83 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|