C29H33ClN4 — CID 135929391
2-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-ylmethyl)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine;hydrochloride (PubChem CID 135929391) has the molecular formula C29H33ClN4 and a molecular weight of 473.06 g/mol. Its IUPAC name is 2-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-ylmethyl)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine;hydrochloride.
| Compound Name | 2-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-ylmethyl)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine;hydrochloride |
|---|---|
| PubChem CID | 135929391 |
| Molecular Formula | C29H33ClN4 |
| Molecular Weight | 473.06 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-ylmethyl)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine;hydrochloride |
| SMILES | CCC1CN2CCc3c([nH]c4ccccc34)C2CC1CC1=NCCc2c1[nH]c1ccccc21.Cl |
| InChI | InChI=1S/C29H32N4.ClH/c1-2-18-17-33-14-12-23-21-8-4-6-10-25(21)32-29(23)27(33)16-19(18)15-26-28-22(11-13-30-26)20-7-3-5-9-24(20)31-28;/h3-10,18-19,27,31-32H,2,11-17H2,1H3;1H |
| InChIKey | YQJBSDDQCGYMNE-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 47.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.06 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|