About N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine
N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine (PubChem CID 135929518) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine.
Molecular Properties
| Compound Name | N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine |
| PubChem CID | 135929518 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine |
| SMILES | CC(C)(C)/N=C1\Nc2ccccc2NC12CCOCC2 |
| InChI | InChI=1S/C16H23N3O/c1-15(2,3)19-14-16(8-10-20-11-9-16)18-13-7-5-4-6-12(13)17-14/h4-7,18H,8-11H2,1-3H3,(H,17,19) |
| InChIKey | SVDANXYSHVVULV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine?
The IUPAC name of N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine (CID 135929518) is N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine.
What is the SMILES notation for N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine?
The canonical SMILES for N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine is CC(C)(C)/N=C1\Nc2ccccc2NC12CCOCC2.
What is the InChIKey of N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine?
The InChIKey is SVDANXYSHVVULV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O/c1-15(2,3)19-14-16(8-10-20-11-9-16)18-13-7-5-4-6-12(13)17-14/h4-7,18H,8-11H2,1-3H3,(H,17,19).
What are the key properties of N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine?
N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine has a molecular weight of 273.38 g/mol, XLogP of 3.27, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine is sourced from PubChem (CID 135929518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).