C35H40N4O4 — CID 135929543
5-[4-(6,7-dihydroxyquinolin-5-yl)-1-[3-[(3S)-3-methylazecan-1-yl]propyl]pyrrol-3-yl]quinoline-6,7-diol (PubChem CID 135929543) has the molecular formula C35H40N4O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is 5-[4-(6,7-dihydroxyquinolin-5-yl)-1-[3-[(3S)-3-methylazecan-1-yl]propyl]pyrrol-3-yl]quinoline-6,7-diol.
| Compound Name | 5-[4-(6,7-dihydroxyquinolin-5-yl)-1-[3-[(3S)-3-methylazecan-1-yl]propyl]pyrrol-3-yl]quinoline-6,7-diol |
|---|---|
| PubChem CID | 135929543 |
| Molecular Formula | C35H40N4O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 5-[4-(6,7-dihydroxyquinolin-5-yl)-1-[3-[(3S)-3-methylazecan-1-yl]propyl]pyrrol-3-yl]quinoline-6,7-diol |
| SMILES | C[C@H]1CCCCCCCN(CCCn2cc(-c3c(O)c(O)cc4ncccc34)c(-c3c(O)c(O)cc4ncccc34)c2)C1 |
| InChI | InChI=1S/C35H40N4O4/c1-23-10-5-3-2-4-6-15-38(20-23)16-9-17-39-21-26(32-24-11-7-13-36-28(24)18-30(40)34(32)42)27(22-39)33-25-12-8-14-37-29(25)19-31(41)35(33)43/h7-8,11-14,18-19,21-23,40-43H,2-6,9-10,15-17,20H2,1H3/t23-/m0/s1 |
| InChIKey | LGDWVQUZDQKWEQ-QHCPKHFHSA-N |
| XLogP | 7.42 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|