About 1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol
1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol (PubChem CID 135929735) has the molecular formula C16H10ClN3O
and a molecular weight of 295.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol |
| PubChem CID | 135929735 |
| Molecular Formula | C16H10ClN3O |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol |
| SMILES | Oc1nc(-c2ccc(Cl)cc2)n2c1cnc1ccccc12 |
| InChI | InChI=1S/C16H10ClN3O/c17-11-7-5-10(6-8-11)15-19-16(21)14-9-18-12-3-1-2-4-13(12)20(14)15/h1-9,21H |
| InChIKey | VDKGSCMEPPVHMG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol?
The IUPAC name of 1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol (CID 135929735) is 1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol.
What is the SMILES notation for 1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol?
The canonical SMILES for 1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol is Oc1nc(-c2ccc(Cl)cc2)n2c1cnc1ccccc12.
What is the InChIKey of 1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol?
The InChIKey is VDKGSCMEPPVHMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN3O/c17-11-7-5-10(6-8-11)15-19-16(21)14-9-18-12-3-1-2-4-13(12)20(14)15/h1-9,21H.
What are the key properties of 1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol?
1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol has a molecular weight of 295.73 g/mol, XLogP of 3.91, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)imidazo[1,5-a]quinoxalin-3-ol is sourced from PubChem (CID 135929735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).