C18H18BrN3O4 — CID 135930180
(8R)-8-(3-bromo-4-ethoxy-5-methoxyphenyl)-6-methyl-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-trien-10-one (PubChem CID 135930180) has the molecular formula C18H18BrN3O4 and a molecular weight of 420.26 g/mol. Its IUPAC name is (8R)-8-(3-bromo-4-ethoxy-5-methoxyphenyl)-6-methyl-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-trien-10-one.
| Compound Name | (8R)-8-(3-bromo-4-ethoxy-5-methoxyphenyl)-6-methyl-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-trien-10-one |
|---|---|
| PubChem CID | 135930180 |
| Molecular Formula | C18H18BrN3O4 |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | (8R)-8-(3-bromo-4-ethoxy-5-methoxyphenyl)-6-methyl-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-trien-10-one |
| SMILES | CCOc1c(Br)cc([C@H]2C3=C(COC3=O)Nc3n[nH]c(C)c32)cc1OC |
| InChI | InChI=1S/C18H18BrN3O4/c1-4-25-16-10(19)5-9(6-12(16)24-3)14-13-8(2)21-22-17(13)20-11-7-26-18(23)15(11)14/h5-6,14H,4,7H2,1-3H3,(H2,20,21,22)/t14-/m1/s1 |
| InChIKey | SOCDDTRLLADQJU-CQSZACIVSA-N |
| XLogP | 3.26 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |