C22H21N3O2S — CID 135931723
(E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine (PubChem CID 135931723) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine.
| Compound Name | (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine |
|---|---|
| PubChem CID | 135931723 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine |
| SMILES | CCOc1ccc(-c2csc(/N=C/c3c[nH]c4ccccc34)n2)c(OCC)c1 |
| InChI | InChI=1S/C22H21N3O2S/c1-3-26-16-9-10-18(21(11-16)27-4-2)20-14-28-22(25-20)24-13-15-12-23-19-8-6-5-7-17(15)19/h5-14,23H,3-4H2,1-2H3/b24-13+ |
| InChIKey | BQOKRGNGLBKKAI-ZMOGYAJESA-N |
| XLogP | 5.84 |
| TPSA | 59.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|