About (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine
(E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine (PubChem CID 135931723) has the molecular formula C22H21N3O2S
and a molecular weight of 391.50 g/mol. Its IUPAC name is (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine.
Molecular Properties
| Compound Name | (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine |
| PubChem CID | 135931723 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine |
| SMILES | CCOc1ccc(-c2csc(/N=C/c3c[nH]c4ccccc34)n2)c(OCC)c1 |
| InChI | InChI=1S/C22H21N3O2S/c1-3-26-16-9-10-18(21(11-16)27-4-2)20-14-28-22(25-20)24-13-15-12-23-19-8-6-5-7-17(15)19/h5-14,23H,3-4H2,1-2H3/b24-13+ |
| InChIKey | BQOKRGNGLBKKAI-ZMOGYAJESA-N |
| XLogP | 5.84 |
| TPSA | 59.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine?
The IUPAC name of (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine (CID 135931723) is (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine.
What is the SMILES notation for (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine?
The canonical SMILES for (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine is CCOc1ccc(-c2csc(/N=C/c3c[nH]c4ccccc34)n2)c(OCC)c1.
What is the InChIKey of (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine?
The InChIKey is BQOKRGNGLBKKAI-ZMOGYAJESA-N. The full InChI is InChI=1S/C22H21N3O2S/c1-3-26-16-9-10-18(21(11-16)27-4-2)20-14-28-22(25-20)24-13-15-12-23-19-8-6-5-7-17(15)19/h5-14,23H,3-4H2,1-2H3/b24-13+.
What are the key properties of (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine?
(E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine has a molecular weight of 391.50 g/mol, XLogP of 5.84, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[4-(2,4-diethoxyphenyl)-1,3-thiazol-2-yl]-1-(1H-indol-3-yl)methanimine is sourced from PubChem (CID 135931723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).