C15H15F3N4O2 — CID 135931990
2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N'-[2-(trifluoromethyl)phenyl]acetohydrazide (PubChem CID 135931990) has the molecular formula C15H15F3N4O2 and a molecular weight of 340.31 g/mol. Its IUPAC name is 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N'-[2-(trifluoromethyl)phenyl]acetohydrazide.
| Compound Name | 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N'-[2-(trifluoromethyl)phenyl]acetohydrazide |
|---|---|
| PubChem CID | 135931990 |
| Molecular Formula | C15H15F3N4O2 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N'-[2-(trifluoromethyl)phenyl]acetohydrazide |
| SMILES | Cc1nc(C)c(CC(=O)NNc2ccccc2C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C15H15F3N4O2/c1-8-10(14(24)20-9(2)19-8)7-13(23)22-21-12-6-4-3-5-11(12)15(16,17)18/h3-6,21H,7H2,1-2H3,(H,22,23)(H,19,20,24) |
| InChIKey | ULLYURPIDBFIDT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|