C27H32N4S — CID 135932152
2-methyl-4-[(3S)-4-methyl-3-(4-phenylbutyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine (PubChem CID 135932152) has the molecular formula C27H32N4S and a molecular weight of 444.65 g/mol. Its IUPAC name is 2-methyl-4-[(3S)-4-methyl-3-(4-phenylbutyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine.
| Compound Name | 2-methyl-4-[(3S)-4-methyl-3-(4-phenylbutyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine |
|---|---|
| PubChem CID | 135932152 |
| Molecular Formula | C27H32N4S |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 2-methyl-4-[(3S)-4-methyl-3-(4-phenylbutyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine |
| SMILES | Cc1cc2c(s1)Nc1ccccc1N=C2N1CCN(C)[C@@H](CCCCc2ccccc2)C1 |
| InChI | InChI=1S/C27H32N4S/c1-20-18-23-26(28-24-14-8-9-15-25(24)29-27(23)32-20)31-17-16-30(2)22(19-31)13-7-6-12-21-10-4-3-5-11-21/h3-5,8-11,14-15,18,22,29H,6-7,12-13,16-17,19H2,1-2H3/t22-/m0/s1 |
| InChIKey | LTHKAOMSIDMPSG-QFIPXVFZSA-N |
| XLogP | 6.22 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|