About diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate
diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate (PubChem CID 135932593) has the molecular formula C15H15NO6
and a molecular weight of 305.29 g/mol. Its IUPAC name is diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate |
| PubChem CID | 135932593 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c(O)c2ncccc2c1O |
| InChI | InChI=1S/C15H15NO6/c1-3-21-14(19)9-10(15(20)22-4-2)13(18)11-8(12(9)17)6-5-7-16-11/h5-7,17-18H,3-4H2,1-2H3 |
| InChIKey | ARYDHCJCPJTMLC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate?
The IUPAC name of diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate (CID 135932593) is diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate.
What is the SMILES notation for diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate?
The canonical SMILES for diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate is CCOC(=O)c1c(C(=O)OCC)c(O)c2ncccc2c1O.
What is the InChIKey of diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate?
The InChIKey is ARYDHCJCPJTMLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO6/c1-3-21-14(19)9-10(15(20)22-4-2)13(18)11-8(12(9)17)6-5-7-16-11/h5-7,17-18H,3-4H2,1-2H3.
What are the key properties of diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate?
diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate has a molecular weight of 305.29 g/mol, XLogP of 2.00, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 5,8-dihydroxyquinoline-6,7-dicarboxylate is sourced from PubChem (CID 135932593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).