C19H27N3O3 — CID 135934834
5-[[(1R)-1-(1-adamantyl)ethyl]iminomethyl]-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 135934834) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 5-[[(1R)-1-(1-adamantyl)ethyl]iminomethyl]-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[[(1R)-1-(1-adamantyl)ethyl]iminomethyl]-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135934834 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 5-[[(1R)-1-(1-adamantyl)ethyl]iminomethyl]-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | C[C@@H](/N=C/c1c(O)n(C)c(=O)n(C)c1=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H27N3O3/c1-11(19-7-12-4-13(8-19)6-14(5-12)9-19)20-10-15-16(23)21(2)18(25)22(3)17(15)24/h10-14,23H,4-9H2,1-3H3/b20-10+/t11-,12?,13?,14?,19?/m1/s1 |
| InChIKey | XPLVLPYIQJDHQW-BKLFOZTASA-N |
| XLogP | 1.81 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|