C20H18F2N2O5S — CID 135935193
[(2S)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl] 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate (PubChem CID 135935193) has the molecular formula C20H18F2N2O5S and a molecular weight of 436.44 g/mol. Its IUPAC name is [(2S)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl] 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate.
| Compound Name | [(2S)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl] 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate |
|---|---|
| PubChem CID | 135935193 |
| Molecular Formula | C20H18F2N2O5S |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | [(2S)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl] 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate |
| SMILES | C[C@H](OC(=O)CCC/N=C1\NS(=O)(=O)c2ccccc21)C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H18F2N2O5S/c1-12(19(26)13-8-9-15(21)16(22)11-13)29-18(25)7-4-10-23-20-14-5-2-3-6-17(14)30(27,28)24-20/h2-3,5-6,8-9,11-12H,4,7,10H2,1H3,(H,23,24)/t12-/m0/s1 |
| InChIKey | DAZHYGAKCBPJCQ-LBPRGKRZSA-N |
| XLogP | 2.60 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|