C24H23F3N4O2 — CID 135935996
3,4-dihydro-2H-quinolin-1-yl-[(5S,7R)-5-(2-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone (PubChem CID 135935996) has the molecular formula C24H23F3N4O2 and a molecular weight of 456.47 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-yl-[(5S,7R)-5-(2-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone.
| Compound Name | 3,4-dihydro-2H-quinolin-1-yl-[(5S,7R)-5-(2-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone |
|---|---|
| PubChem CID | 135935996 |
| Molecular Formula | C24H23F3N4O2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-yl-[(5S,7R)-5-(2-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone |
| SMILES | COc1ccccc1[C@@H]1C[C@H](C(F)(F)F)n2ncc(C(=O)N3CCCc4ccccc43)c2N1 |
| InChI | InChI=1S/C24H23F3N4O2/c1-33-20-11-5-3-9-16(20)18-13-21(24(25,26)27)31-22(29-18)17(14-28-31)23(32)30-12-6-8-15-7-2-4-10-19(15)30/h2-5,7,9-11,14,18,21,29H,6,8,12-13H2,1H3/t18-,21+/m0/s1 |
| InChIKey | MHDKRQQHLCMGSP-GHTZIAJQSA-N |
| XLogP | 5.14 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |