About 4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide
4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 135936842) has the molecular formula C12H15N5O2
and a molecular weight of 261.29 g/mol. Its IUPAC name is 4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide.
Molecular Properties
| Compound Name | 4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide |
| PubChem CID | 135936842 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC(C)c1cccc(/N=C(\NO)c2nonc2N)c1 |
| InChI | InChI=1S/C12H15N5O2/c1-7(2)8-4-3-5-9(6-8)14-12(15-18)10-11(13)17-19-16-10/h3-7,18H,1-2H3,(H2,13,17)(H,14,15) |
| InChIKey | MHDAOJWVQGRNDF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide?
The IUPAC name of 4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide (CID 135936842) is 4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide.
What is the SMILES notation for 4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide?
The canonical SMILES for 4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide is CC(C)c1cccc(/N=C(\NO)c2nonc2N)c1.
What is the InChIKey of 4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide?
The InChIKey is MHDAOJWVQGRNDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5O2/c1-7(2)8-4-3-5-9(6-8)14-12(15-18)10-11(13)17-19-16-10/h3-7,18H,1-2H3,(H2,13,17)(H,14,15).
What are the key properties of 4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide?
4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide has a molecular weight of 261.29 g/mol, XLogP of 1.83, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-hydroxy-N'-(3-propan-2-ylphenyl)-1,2,5-oxadiazole-3-carboximidamide is sourced from PubChem (CID 135936842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).