C60H88N4O4 — CID 135936915
6-[4-(1-benzylpyrrol-2-yl)-6-[4-(2-hexyldecoxy)-2-hydroxy-3-methylphenyl]-1,3,5-triazin-2-yl]-3-(2-hexyldecoxy)-2-methylphenol (PubChem CID 135936915) has the molecular formula C60H88N4O4 and a molecular weight of 929.39 g/mol. Its IUPAC name is 6-[4-(1-benzylpyrrol-2-yl)-6-[4-(2-hexyldecoxy)-2-hydroxy-3-methylphenyl]-1,3,5-triazin-2-yl]-3-(2-hexyldecoxy)-2-methylphenol.
| Compound Name | 6-[4-(1-benzylpyrrol-2-yl)-6-[4-(2-hexyldecoxy)-2-hydroxy-3-methylphenyl]-1,3,5-triazin-2-yl]-3-(2-hexyldecoxy)-2-methylphenol |
|---|---|
| PubChem CID | 135936915 |
| Molecular Formula | C60H88N4O4 |
| Molecular Weight | 929.39 g/mol |
| Exact Mass | 928.68 |
| IUPAC Name | 6-[4-(1-benzylpyrrol-2-yl)-6-[4-(2-hexyldecoxy)-2-hydroxy-3-methylphenyl]-1,3,5-triazin-2-yl]-3-(2-hexyldecoxy)-2-methylphenol |
| SMILES | CCCCCCCCC(CCCCCC)COc1ccc(-c2nc(-c3ccc(OCC(CCCCCC)CCCCCCCC)c(C)c3O)nc(-c3cccn3Cc3ccccc3)n2)c(O)c1C |
| InChI | InChI=1S/C60H88N4O4/c1-7-11-15-19-21-26-35-49(33-24-17-13-9-3)44-67-54-40-38-51(56(65)46(54)5)58-61-59(63-60(62-58)53-37-30-42-64(53)43-48-31-28-23-29-32-48)52-39-41-55(47(6)57(52)66)68-45-50(34-25-18-14-10-4)36-27-22-20-16-12-8-2/h23,28-32,37-42,49-50,65-66H,7-22,24-27,33-36,43-45H2,1-6H3 |
| InChIKey | HEVXWFARGUWFCH-UHFFFAOYSA-N |
| XLogP | 17.18 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.39 |
| LogP ≤ 5 | 17.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|