About 4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol
4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol (PubChem CID 135937299) has the molecular formula C21H16ClNO2
and a molecular weight of 349.82 g/mol. Its IUPAC name is 4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol.
Molecular Properties
| Compound Name | 4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol |
| PubChem CID | 135937299 |
| Molecular Formula | C21H16ClNO2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol |
| SMILES | Oc1ccc(C2=Nc3ccccc3OC(c3ccccc3Cl)C2)cc1 |
| InChI | InChI=1S/C21H16ClNO2/c22-17-6-2-1-5-16(17)21-13-19(14-9-11-15(24)12-10-14)23-18-7-3-4-8-20(18)25-21/h1-12,21,24H,13H2 |
| InChIKey | TXDYHOBHEBBEKZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol?
The IUPAC name of 4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol (CID 135937299) is 4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol.
What is the SMILES notation for 4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol?
The canonical SMILES for 4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol is Oc1ccc(C2=Nc3ccccc3OC(c3ccccc3Cl)C2)cc1.
What is the InChIKey of 4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol?
The InChIKey is TXDYHOBHEBBEKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16ClNO2/c22-17-6-2-1-5-16(17)21-13-19(14-9-11-15(24)12-10-14)23-18-7-3-4-8-20(18)25-21/h1-12,21,24H,13H2.
What are the key properties of 4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol?
4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol has a molecular weight of 349.82 g/mol, XLogP of 5.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-chlorophenyl)-2,3-dihydro-1,5-benzoxazepin-4-yl]phenol is sourced from PubChem (CID 135937299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).