About 3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide
3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide (PubChem CID 135937902) has the molecular formula C8H7BrN2O2
and a molecular weight of 243.06 g/mol. Its IUPAC name is 3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide.
Molecular Properties
| Compound Name | 3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide |
| PubChem CID | 135937902 |
| Molecular Formula | C8H7BrN2O2 |
| Molecular Weight | 243.06 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide |
| SMILES | Br.O=c1[nH]c2cnccc2cc1O |
| InChI | InChI=1S/C8H6N2O2.BrH/c11-7-3-5-1-2-9-4-6(5)10-8(7)12;/h1-4,11H,(H,10,12);1H |
| InChIKey | XOXGUZASZBYWFL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.06 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide?
The IUPAC name of 3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide (CID 135937902) is 3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide.
What is the SMILES notation for 3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide?
The canonical SMILES for 3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide is Br.O=c1[nH]c2cnccc2cc1O.
What is the InChIKey of 3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide?
The InChIKey is XOXGUZASZBYWFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2.BrH/c11-7-3-5-1-2-9-4-6(5)10-8(7)12;/h1-4,11H,(H,10,12);1H.
What are the key properties of 3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide?
3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide has a molecular weight of 243.06 g/mol, XLogP of 1.21, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1H-1,7-naphthyridin-2-one;hydrobromide is sourced from PubChem (CID 135937902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).