C17H21N5O2 — CID 135938217
(7R)-N-(2,5-dimethylphenyl)-5-oxo-2-propan-2-ylidene-1,4,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 135938217) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is (7R)-N-(2,5-dimethylphenyl)-5-oxo-2-propan-2-ylidene-1,4,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | (7R)-N-(2,5-dimethylphenyl)-5-oxo-2-propan-2-ylidene-1,4,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 135938217 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (7R)-N-(2,5-dimethylphenyl)-5-oxo-2-propan-2-ylidene-1,4,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | CC(C)=C1N=C2NC(=O)C[C@H](C(=O)Nc3cc(C)ccc3C)N2N1 |
| InChI | InChI=1S/C17H21N5O2/c1-9(2)15-20-17-19-14(23)8-13(22(17)21-15)16(24)18-12-7-10(3)5-6-11(12)4/h5-7,13,21H,8H2,1-4H3,(H,18,24)(H,19,20,23)/t13-/m1/s1 |
| InChIKey | DOXPEIHCRKTVTF-CYBMUJFWSA-N |
| XLogP | 1.56 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |