About 4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one
4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one (PubChem CID 135938780) has the molecular formula C13H11N3O2S
and a molecular weight of 273.32 g/mol. Its IUPAC name is 4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one |
| PubChem CID | 135938780 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one |
| SMILES | CC(=O)C(/N=N/c1nccs1)=C(O)c1ccccc1 |
| InChI | InChI=1S/C13H11N3O2S/c1-9(17)11(15-16-13-14-7-8-19-13)12(18)10-5-3-2-4-6-10/h2-8,18H,1H3/b12-11?,16-15+ |
| InChIKey | WFDZFZPVSWJUTO-DUISWRSGSA-N |
| XLogP | 3.74 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one?
The IUPAC name of 4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one (CID 135938780) is 4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one.
What is the SMILES notation for 4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one?
The canonical SMILES for 4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one is CC(=O)C(/N=N/c1nccs1)=C(O)c1ccccc1.
What is the InChIKey of 4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one?
The InChIKey is WFDZFZPVSWJUTO-DUISWRSGSA-N. The full InChI is InChI=1S/C13H11N3O2S/c1-9(17)11(15-16-13-14-7-8-19-13)12(18)10-5-3-2-4-6-10/h2-8,18H,1H3/b12-11?,16-15+.
What are the key properties of 4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one?
4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one has a molecular weight of 273.32 g/mol, XLogP of 3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-4-phenyl-3-(1,3-thiazol-2-yldiazenyl)but-3-en-2-one is sourced from PubChem (CID 135938780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).