C19H18FN3O3 — CID 135939363
methyl 2-[[(3-fluorophenyl)methyl-methylamino]methyl]-4-oxo-3H-quinazoline-7-carboxylate (PubChem CID 135939363) has the molecular formula C19H18FN3O3 and a molecular weight of 355.37 g/mol. Its IUPAC name is methyl 2-[[(3-fluorophenyl)methyl-methylamino]methyl]-4-oxo-3H-quinazoline-7-carboxylate.
| Compound Name | methyl 2-[[(3-fluorophenyl)methyl-methylamino]methyl]-4-oxo-3H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 135939363 |
| Molecular Formula | C19H18FN3O3 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | methyl 2-[[(3-fluorophenyl)methyl-methylamino]methyl]-4-oxo-3H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)[nH]c(CN(C)Cc3cccc(F)c3)nc2c1 |
| InChI | InChI=1S/C19H18FN3O3/c1-23(10-12-4-3-5-14(20)8-12)11-17-21-16-9-13(19(25)26-2)6-7-15(16)18(24)22-17/h3-9H,10-11H2,1-2H3,(H,21,22,24) |
| InChIKey | VCQWWAWKZLRSJV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |