C16H15I2N3O2 — CID 135939477
N-[(E)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-2-(2-methylanilino)acetamide (PubChem CID 135939477) has the molecular formula C16H15I2N3O2 and a molecular weight of 535.12 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-2-(2-methylanilino)acetamide.
| Compound Name | N-[(E)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-2-(2-methylanilino)acetamide |
|---|---|
| PubChem CID | 135939477 |
| Molecular Formula | C16H15I2N3O2 |
| Molecular Weight | 535.12 g/mol |
| Exact Mass | 534.93 |
| IUPAC Name | N-[(E)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-2-(2-methylanilino)acetamide |
| SMILES | Cc1ccccc1NCC(=O)N/N=C/c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C16H15I2N3O2/c1-10-4-2-3-5-14(10)19-9-15(22)21-20-8-11-6-12(17)16(23)13(18)7-11/h2-8,19,23H,9H2,1H3,(H,21,22)/b20-8+ |
| InChIKey | MJUKRXYINHFHSB-DNTJNYDQSA-N |
| XLogP | 3.47 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.12 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|