About 4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol
4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol (PubChem CID 135939538) has the molecular formula C19H11BrClN3O2
and a molecular weight of 428.67 g/mol. Its IUPAC name is 4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol.
Molecular Properties
| Compound Name | 4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol |
| PubChem CID | 135939538 |
| Molecular Formula | C19H11BrClN3O2 |
| Molecular Weight | 428.67 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | 4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol |
| SMILES | Oc1c(Cl)cc(Br)cc1/C=N/c1ccc(-c2nc3ncccc3o2)cc1 |
| InChI | InChI=1S/C19H11BrClN3O2/c20-13-8-12(17(25)15(21)9-13)10-23-14-5-3-11(4-6-14)19-24-18-16(26-19)2-1-7-22-18/h1-10,25H/b23-10+ |
| InChIKey | ZNXKIGHBINIOJX-AUEPDCJTSA-N |
| XLogP | 5.76 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.67 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol?
The IUPAC name of 4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol (CID 135939538) is 4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol.
What is the SMILES notation for 4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol?
The canonical SMILES for 4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol is Oc1c(Cl)cc(Br)cc1/C=N/c1ccc(-c2nc3ncccc3o2)cc1.
What is the InChIKey of 4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol?
The InChIKey is ZNXKIGHBINIOJX-AUEPDCJTSA-N. The full InChI is InChI=1S/C19H11BrClN3O2/c20-13-8-12(17(25)15(21)9-13)10-23-14-5-3-11(4-6-14)19-24-18-16(26-19)2-1-7-22-18/h1-10,25H/b23-10+.
What are the key properties of 4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol?
4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol has a molecular weight of 428.67 g/mol, XLogP of 5.76, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-chloro-6-[[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]iminomethyl]phenol is sourced from PubChem (CID 135939538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).