C22H23IN4O2 — CID 135939833
4-[[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]iminomethyl]-3-hydroxy-6-iodo-2H-isoquinolin-1-one (PubChem CID 135939833) has the molecular formula C22H23IN4O2 and a molecular weight of 502.36 g/mol. Its IUPAC name is 4-[[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]iminomethyl]-3-hydroxy-6-iodo-2H-isoquinolin-1-one.
| Compound Name | 4-[[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]iminomethyl]-3-hydroxy-6-iodo-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 135939833 |
| Molecular Formula | C22H23IN4O2 |
| Molecular Weight | 502.36 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 4-[[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]iminomethyl]-3-hydroxy-6-iodo-2H-isoquinolin-1-one |
| SMILES | C[C@@H]1CN(c2ccc(/N=C/c3c(O)[nH]c(=O)c4ccc(I)cc34)cc2)C[C@H](C)N1 |
| InChI | InChI=1S/C22H23IN4O2/c1-13-11-27(12-14(2)25-13)17-6-4-16(5-7-17)24-10-20-19-9-15(23)3-8-18(19)21(28)26-22(20)29/h3-10,13-14,25H,11-12H2,1-2H3,(H2,26,28,29)/b24-10+/t13-,14+ |
| InChIKey | VJGBKNPZBQFKIN-WSKZGTOUSA-N |
| XLogP | 3.78 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|