C23H25IN4O2 — CID 135939836
3-hydroxy-6-iodo-4-[[4-[(2S,5R)-2,4,5-trimethylpiperazin-1-yl]phenyl]iminomethyl]-2H-isoquinolin-1-one (PubChem CID 135939836) has the molecular formula C23H25IN4O2 and a molecular weight of 516.38 g/mol. Its IUPAC name is 3-hydroxy-6-iodo-4-[[4-[(2S,5R)-2,4,5-trimethylpiperazin-1-yl]phenyl]iminomethyl]-2H-isoquinolin-1-one.
| Compound Name | 3-hydroxy-6-iodo-4-[[4-[(2S,5R)-2,4,5-trimethylpiperazin-1-yl]phenyl]iminomethyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 135939836 |
| Molecular Formula | C23H25IN4O2 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 3-hydroxy-6-iodo-4-[[4-[(2S,5R)-2,4,5-trimethylpiperazin-1-yl]phenyl]iminomethyl]-2H-isoquinolin-1-one |
| SMILES | C[C@@H]1CN(c2ccc(/N=C/c3c(O)[nH]c(=O)c4ccc(I)cc34)cc2)[C@@H](C)CN1C |
| InChI | InChI=1S/C23H25IN4O2/c1-14-13-28(15(2)12-27(14)3)18-7-5-17(6-8-18)25-11-21-20-10-16(24)4-9-19(20)22(29)26-23(21)30/h4-11,14-15H,12-13H2,1-3H3,(H2,26,29,30)/b25-11+/t14-,15+/m1/s1 |
| InChIKey | ASAAFJGCJAJLPE-UZDCQUFSSA-N |
| XLogP | 4.12 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|