C23H22N2O6S — CID 135941608
2-[4-[(E)-[2-(3-acetylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]butanoic acid (PubChem CID 135941608) has the molecular formula C23H22N2O6S and a molecular weight of 454.50 g/mol. Its IUPAC name is 2-[4-[(E)-[2-(3-acetylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]butanoic acid.
| Compound Name | 2-[4-[(E)-[2-(3-acetylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 135941608 |
| Molecular Formula | C23H22N2O6S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-[4-[(E)-[2-(3-acetylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(/C=C2/S/C(=N\c3cccc(C(C)=O)c3)NC2=O)cc1OC)C(=O)O |
| InChI | InChI=1S/C23H22N2O6S/c1-4-17(22(28)29)31-18-9-8-14(10-19(18)30-3)11-20-21(27)25-23(32-20)24-16-7-5-6-15(12-16)13(2)26/h5-12,17H,4H2,1-3H3,(H,28,29)(H,24,25,27)/b20-11+ |
| InChIKey | UVDQNVRHUMSEPP-RGVLZGJSSA-N |
| XLogP | 4.03 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|