C15H13N3O3 — CID 135941989
N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]furan-3-carboxamide (PubChem CID 135941989) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]furan-3-carboxamide.
| Compound Name | N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 135941989 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]furan-3-carboxamide |
| SMILES | CN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)c1ccoc1 |
| InChI | InChI=1S/C15H13N3O3/c1-18(15(20)10-6-7-21-9-10)8-13-16-12-5-3-2-4-11(12)14(19)17-13/h2-7,9H,8H2,1H3,(H,16,17,19) |
| InChIKey | SOCQGSRFUCFNPT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |