C22H17N5O5 — CID 135942149
6-[(6-nitro-4-oxochromen-3-yl)methyl]-2-pyridin-3-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135942149) has the molecular formula C22H17N5O5 and a molecular weight of 431.41 g/mol. Its IUPAC name is 6-[(6-nitro-4-oxochromen-3-yl)methyl]-2-pyridin-3-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(6-nitro-4-oxochromen-3-yl)methyl]-2-pyridin-3-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135942149 |
| Molecular Formula | C22H17N5O5 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 6-[(6-nitro-4-oxochromen-3-yl)methyl]-2-pyridin-3-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2cccnc2)nc2c1CN(Cc1coc3ccc([N+](=O)[O-])cc3c1=O)CC2 |
| InChI | InChI=1S/C22H17N5O5/c28-20-14(12-32-19-4-3-15(27(30)31)8-16(19)20)10-26-7-5-18-17(11-26)22(29)25-21(24-18)13-2-1-6-23-9-13/h1-4,6,8-9,12H,5,7,10-11H2,(H,24,25,29) |
| InChIKey | JBUHCISCZOWOSL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 135.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|