C22H32N6OS — CID 135943077
2-cyclohexyl-6-[[2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135943077) has the molecular formula C22H32N6OS and a molecular weight of 428.61 g/mol. Its IUPAC name is 2-cyclohexyl-6-[[2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-cyclohexyl-6-[[2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135943077 |
| Molecular Formula | C22H32N6OS |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 2-cyclohexyl-6-[[2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CN1CCN(c2ncc(CN3CCc4nc(C5CCCCC5)[nH]c(=O)c4C3)s2)CC1 |
| InChI | InChI=1S/C22H32N6OS/c1-26-9-11-28(12-10-26)22-23-13-17(30-22)14-27-8-7-19-18(15-27)21(29)25-20(24-19)16-5-3-2-4-6-16/h13,16H,2-12,14-15H2,1H3,(H,24,25,29) |
| InChIKey | DPJZHYHEDCECNA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |