C24H21ClN4O — CID 135943384
6-[(2-chloro-6-methylquinolin-3-yl)methyl]-2-phenyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135943384) has the molecular formula C24H21ClN4O and a molecular weight of 416.91 g/mol. Its IUPAC name is 6-[(2-chloro-6-methylquinolin-3-yl)methyl]-2-phenyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(2-chloro-6-methylquinolin-3-yl)methyl]-2-phenyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135943384 |
| Molecular Formula | C24H21ClN4O |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 6-[(2-chloro-6-methylquinolin-3-yl)methyl]-2-phenyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc2nc(Cl)c(CN3CCc4nc(-c5ccccc5)[nH]c(=O)c4C3)cc2c1 |
| InChI | InChI=1S/C24H21ClN4O/c1-15-7-8-20-17(11-15)12-18(22(25)26-20)13-29-10-9-21-19(14-29)24(30)28-23(27-21)16-5-3-2-4-6-16/h2-8,11-12H,9-10,13-14H2,1H3,(H,27,28,30) |
| InChIKey | UXFPLLWQHNYMSU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|