C22H23ClN4O3 — CID 135943501
2-tert-butyl-6-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135943501) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is 2-tert-butyl-6-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-tert-butyl-6-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135943501 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 2-tert-butyl-6-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CC(C)(C)c1nc2c(c(=O)[nH]1)CN(Cc1cc3cc4c(cc3nc1Cl)OCO4)CC2 |
| InChI | InChI=1S/C22H23ClN4O3/c1-22(2,3)21-25-15-4-5-27(10-14(15)20(28)26-21)9-13-6-12-7-17-18(30-11-29-17)8-16(12)24-19(13)23/h6-8H,4-5,9-11H2,1-3H3,(H,25,26,28) |
| InChIKey | WOIWHFJJEVWYER-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|