C18H15Cl2N3O3S — CID 135944198
6-[(4,6-dichloro-2-oxochromen-3-yl)methyl]-2-methylsulfanyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135944198) has the molecular formula C18H15Cl2N3O3S and a molecular weight of 424.31 g/mol. Its IUPAC name is 6-[(4,6-dichloro-2-oxochromen-3-yl)methyl]-2-methylsulfanyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(4,6-dichloro-2-oxochromen-3-yl)methyl]-2-methylsulfanyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135944198 |
| Molecular Formula | C18H15Cl2N3O3S |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 6-[(4,6-dichloro-2-oxochromen-3-yl)methyl]-2-methylsulfanyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CSc1nc2c(c(=O)[nH]1)CN(Cc1c(Cl)c3cc(Cl)ccc3oc1=O)CC2 |
| InChI | InChI=1S/C18H15Cl2N3O3S/c1-27-18-21-13-4-5-23(7-11(13)16(24)22-18)8-12-15(20)10-6-9(19)2-3-14(10)26-17(12)25/h2-3,6H,4-5,7-8H2,1H3,(H,21,22,24) |
| InChIKey | GCTJXKDLKVPRNS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|