C20H19Cl2N3O3 — CID 135944200
6-[(4,6-dichloro-2-oxochromen-3-yl)methyl]-2-propan-2-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135944200) has the molecular formula C20H19Cl2N3O3 and a molecular weight of 420.30 g/mol. Its IUPAC name is 6-[(4,6-dichloro-2-oxochromen-3-yl)methyl]-2-propan-2-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(4,6-dichloro-2-oxochromen-3-yl)methyl]-2-propan-2-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135944200 |
| Molecular Formula | C20H19Cl2N3O3 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 6-[(4,6-dichloro-2-oxochromen-3-yl)methyl]-2-propan-2-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CC(C)c1nc2c(c(=O)[nH]1)CN(Cc1c(Cl)c3cc(Cl)ccc3oc1=O)CC2 |
| InChI | InChI=1S/C20H19Cl2N3O3/c1-10(2)18-23-15-5-6-25(8-13(15)19(26)24-18)9-14-17(22)12-7-11(21)3-4-16(12)28-20(14)27/h3-4,7,10H,5-6,8-9H2,1-2H3,(H,23,24,26) |
| InChIKey | NHAHOQCXROFZDP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|