C17H14Cl2N4O3 — CID 135944205
2-amino-6-[(4,6-dichloro-2-oxochromen-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135944205) has the molecular formula C17H14Cl2N4O3 and a molecular weight of 393.23 g/mol. Its IUPAC name is 2-amino-6-[(4,6-dichloro-2-oxochromen-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-6-[(4,6-dichloro-2-oxochromen-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135944205 |
| Molecular Formula | C17H14Cl2N4O3 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 2-amino-6-[(4,6-dichloro-2-oxochromen-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)CN(Cc1c(Cl)c3cc(Cl)ccc3oc1=O)CC2 |
| InChI | InChI=1S/C17H14Cl2N4O3/c18-8-1-2-13-9(5-8)14(19)11(16(25)26-13)7-23-4-3-12-10(6-23)15(24)22-17(20)21-12/h1-2,5H,3-4,6-7H2,(H3,20,21,22,24) |
| InChIKey | LUQRCWQFWAXWFC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|