C21H21BrClN3O3 — CID 135944241
6-[(6-bromo-4-chloro-2-oxochromen-3-yl)methyl]-2-tert-butyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135944241) has the molecular formula C21H21BrClN3O3 and a molecular weight of 478.77 g/mol. Its IUPAC name is 6-[(6-bromo-4-chloro-2-oxochromen-3-yl)methyl]-2-tert-butyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(6-bromo-4-chloro-2-oxochromen-3-yl)methyl]-2-tert-butyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135944241 |
| Molecular Formula | C21H21BrClN3O3 |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 6-[(6-bromo-4-chloro-2-oxochromen-3-yl)methyl]-2-tert-butyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CC(C)(C)c1nc2c(c(=O)[nH]1)CN(Cc1c(Cl)c3cc(Br)ccc3oc1=O)CC2 |
| InChI | InChI=1S/C21H21BrClN3O3/c1-21(2,3)20-24-15-6-7-26(9-13(15)18(27)25-20)10-14-17(23)12-8-11(22)4-5-16(12)29-19(14)28/h4-5,8H,6-7,9-10H2,1-3H3,(H,24,25,27) |
| InChIKey | RZIVRIJGAANSRL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|